Galtamycin B
Modify Date: 2025-08-28 18:39:37
Galtamycin B structure
|
Common Name | Galtamycin B | ||
|---|---|---|---|---|
| CAS Number | 855779-79-2 | Molecular Weight | 804.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H48O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Galtamycin B |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C43H48O15 |
|---|---|
| Molecular Weight | 804.8 |
| InChIKey | NWYUSUAHSWSTCK-UHCMZIKDSA-N |
| SMILES | Cc1cc(O)c2cc3c(c(O)c2c1)C(=O)c1ccc(C2CC(O)C(OC4CC(O)C(OC5CCC(OC6C=CC(=O)C(C)O6)C(C)O5)C(C)O4)C(C)O2)c(O)c1C3=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Galtamycin B? |
| A: The English name of Galtamycin B is Galtamycin B. |
| Q: What is the InChIKey of Galtamycin B? |
| A: InChIKey of Galtamycin B is NWYUSUAHSWSTCK-UHCMZIKDSA-N. |
| Q: What is the molecular formula of Galtamycin B? |
| A: Molecular formula of Galtamycin B is C43H48O15. |
| Q: What is the CAS number of Galtamycin B? |
| A: CAS number of Galtamycin B is 855779-79-2. |
| Q: What is the SMILES notation of Galtamycin B? |
| A: SMILES notation of Galtamycin B is Cc1cc(O)c2cc3c(c(O)c2c1)C(=O)c1ccc(C2CC(O)C(OC4CC(O)C(OC5CCC(OC6C=CC(=O)C(C)O6)C(C)O5)C(C)O4)C(C)O2)c(O)c1C3=O. |
| Q: What is the molecular weight of Galtamycin B? |
| A: Molecular weight of Galtamycin B is 804.8. |
| Q: What is the Chinese name of 855779-79-2? |
| A: Chinese name of 855779-79-2 is 855779-79-2. |