4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline
![4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline Structure](https://image.chemsrc.com/caspic/257/85583-40-0.png)
4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline structure
|
Common Name | 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 85583-40-0 | Molecular Weight | 242.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18N2O |
|---|---|
| Molecular Weight | 242.31600 |
| Exact Mass | 242.14200 |
| PSA | 48.14000 |
| LogP | 3.42890 |
| InChIKey | IDEJJBCHUQNLIB-UHFFFAOYSA-N |
| SMILES | CCc1ccc(CCOc2ccc(N)cc2)nc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
4-[2-(5-ethylpy... CAS#:85583-40-0 |
| Literature: MOREPEN LABORATORIES LIMITED Patent: WO2006/35459 A1, 2006 ; Location in patent: Page/Page column 21; 22 ; |
|
~%
4-[2-(5-ethylpy... CAS#:85583-40-0 |
| Literature: Kumar; Reddy; Eswaraiah; Mukkanti; Suryanarayana Pharmazie, 2004 , vol. 59, # 11 p. 836 - 839 |
|
~%
4-[2-(5-ethylpy... CAS#:85583-40-0 |
| Literature: Kumar; Reddy; Eswaraiah; Mukkanti; Suryanarayana Pharmazie, 2004 , vol. 59, # 11 p. 836 - 839 |
![5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine structure](https://image.chemsrc.com/caspic/398/85583-54-6.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-[2-(5-ethyl-2-pyridyI)ethoxy]aniline |
| pioglitazone amino ether |
| 2-[2-(4-Aminophenoxy)]ethyl-5-ethyl-pyridine |
| 4-[2-(5-ethyl-2-pyridyl)ethoxy]aniline |
| Benzenamine,4-[2-(5-ethyl-2-pyridinyl)ethoxy] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: Molecular weight of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is 242.31600. |
| Q: What is the LogP of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: LogP of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is 3.42890. |
| Q: What is the SMILES notation of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: SMILES notation of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is CCc1ccc(CCOc2ccc(N)cc2)nc1. |
| Q: What is the polar surface area (PSA) of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: Polar surface area (PSA) of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is 48.14000. |
| Q: What is the English name of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: The English name of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline. |
| Q: What is the CAS number of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: CAS number of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is 85583-40-0. |
| Q: What is the molecular formula of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: Molecular formula of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is C15H18N2O. |
| Q: What English synonyms does 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline have? |
| A: English synonyms of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline: 4-[2-(5-ethyl-2-pyridyI)ethoxy]aniline, pioglitazone amino ether, 2-[2-(4-Aminophenoxy)]ethyl-5-ethyl-pyridine, 4-[2-(5-ethyl-2-pyridyl)ethoxy]aniline, Benzenamine,4-[2-(5-ethyl-2-pyridinyl)ethoxy]. |
| Q: What is the InChIKey of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline? |
| A: InChIKey of 4-[2-(5-ethylpyridin-2-yl)ethoxy]aniline is IDEJJBCHUQNLIB-UHFFFAOYSA-N. |