isopropylnaphthalene-1-sulphonic acid, compound with 2-aminoethanol (1:1) structure
|
Common Name | isopropylnaphthalene-1-sulphonic acid, compound with 2-aminoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 85586-85-2 | Molecular Weight | 311.39700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-aminoethanol,2-propan-2-ylnaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21NO4S |
|---|---|
| Molecular Weight | 311.39700 |
| Exact Mass | 311.11900 |
| PSA | 109.00000 |
| LogP | 3.92840 |
| InChIKey | BAWYTOQUFTYLMG-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc2ccccc2c1S(=O)(=O)O.NCCO |
| isopropylnaphthalene-1-sulfonic acid compound with 2-aminoethanol (1:1) |