4,4',6,6'-Tetrachloro-2,2'-bipyridine
Modify Date: 2025-10-05 09:04:12
4,4',6,6'-Tetrachloro-2,2'-bipyridine structure
|
Common Name | 4,4',6,6'-Tetrachloro-2,2'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 85591-66-8 | Molecular Weight | 294.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4Cl4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4',6,6'-Tetrachloro-2,2'-bipyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H4Cl4N2 |
|---|---|
| Molecular Weight | 294.0 |
| InChIKey | GKLMSNSBUBPZQU-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)nc(-c2cc(Cl)cc(Cl)n2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,4',6,6'-Tetrachloro-2,2'-bipyridine? |
| A: The English name of 4,4',6,6'-Tetrachloro-2,2'-bipyridine is 4,4',6,6'-Tetrachloro-2,2'-bipyridine. |
| Q: What is the InChIKey of 4,4',6,6'-Tetrachloro-2,2'-bipyridine? |
| A: InChIKey of 4,4',6,6'-Tetrachloro-2,2'-bipyridine is GKLMSNSBUBPZQU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4,4',6,6'-Tetrachloro-2,2'-bipyridine? |
| A: CAS number of 4,4',6,6'-Tetrachloro-2,2'-bipyridine is 85591-66-8. |
| Q: What is the SMILES notation of 4,4',6,6'-Tetrachloro-2,2'-bipyridine? |
| A: SMILES notation of 4,4',6,6'-Tetrachloro-2,2'-bipyridine is Clc1cc(Cl)nc(-c2cc(Cl)cc(Cl)n2)c1. |
| Q: What is the molecular formula of 4,4',6,6'-Tetrachloro-2,2'-bipyridine? |
| A: Molecular formula of 4,4',6,6'-Tetrachloro-2,2'-bipyridine is C10H4Cl4N2. |
| Q: What is the Chinese name of 85591-66-8? |
| A: Chinese name of 85591-66-8 is 85591-66-8. |
| Q: What is the molecular weight of 4,4',6,6'-Tetrachloro-2,2'-bipyridine? |
| A: Molecular weight of 4,4',6,6'-Tetrachloro-2,2'-bipyridine is 294.0. |