bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium
![bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium Structure](https://image.chemsrc.com/caspic/477/85599-10-6.png)
bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium structure
|
Common Name | bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium | ||
|---|---|---|---|---|
| CAS Number | 85599-10-6 | Molecular Weight | 345.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O3P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H26O3P+ |
|---|---|
| Molecular Weight | 345.39200 |
| Exact Mass | 345.16200 |
| PSA | 69.67000 |
| LogP | 4.81940 |
| InChIKey | SMDKITMDGBWCIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Oc1ccccc1[P+](=O)c1ccccc1OC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis[2-[(2-methy... CAS#:85599-10-6 |
| Literature: Wife, Richard L.; Oort, Aart B. van; Doorn, Johannes A. van; Leeuwen, Piet W. N. M. van Synthesis, 1983 , # 1 p. 71 - 73 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphine oxide,bis[2-(1,1-dimethylethoxy)phenyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 85599-10-6? |
| A: Chinese name of 85599-10-6 is 85599-10-6. |
| Q: What is the molecular weight of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: Molecular weight of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is 345.39200. |
| Q: What is the CAS number of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: CAS number of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is 85599-10-6. |
| Q: What is the molecular formula of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: Molecular formula of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is C20H26O3P+. |
| Q: What English synonyms does bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium have? |
| A: English synonyms of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium: Phosphine oxide,bis[2-(1,1-dimethylethoxy)phenyl]. |
| Q: What is the English name of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: The English name of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium. |
| Q: What is the LogP of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: LogP of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is 4.81940. |
| Q: What is the InChIKey of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: InChIKey of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is SMDKITMDGBWCIN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: SMILES notation of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is CC(C)(C)Oc1ccccc1[P+](=O)c1ccccc1OC(C)(C)C. |
| Q: What is the polar surface area (PSA) of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium? |
| A: Polar surface area (PSA) of bis[2-[(2-methylpropan-2-yl)oxy]phenyl]-oxophosphanium is 69.67000. |