5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carbonitrile structure
|
Common Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 85619-10-9 | Molecular Weight | 271.31600 | |
| Density | 1.31g/cm3 | Boiling Point | 569.2ºC at 760 mmHg | |
| Molecular Formula | C18H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1ºC | |
| Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 569.2ºC at 760 mmHg |
| Molecular Formula | C18H13N3 |
| Molecular Weight | 271.31600 |
| Flash Point | 170.1ºC |
| Exact Mass | 271.11100 |
| PSA | 52.47000 |
| LogP | 4.35778 |
| Index of Refraction | 1.762 |
| InChIKey | YIEMZXAIUNCXMR-UHFFFAOYSA-N |
| SMILES | Cc1c2ccnc(C#N)c2c(C)c2c1[nH]c1ccccc12 |
|
~91%
5,11-dimethyl-6... CAS#:85619-10-9 |
| Literature: Popp; Veeraraghaven Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 6 p. 1275 - 1280 |
|
~%
5,11-dimethyl-6... CAS#:85619-10-9 |
| Literature: Popp; Veeraraghaven Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 6 p. 1275 - 1280 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-cyanoellipticine |