2-benzamido-3-(1H-indol-3-yl)prop-2-enoic acid structure
|
Common Name | 2-benzamido-3-(1H-indol-3-yl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 85622-38-4 | Molecular Weight | 306.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzamido-3-(1H-indol-3-yl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14N2O3 |
|---|---|
| Molecular Weight | 306.31500 |
| Exact Mass | 306.10000 |
| PSA | 85.68000 |
| LogP | 3.59820 |
| InChIKey | HVTVLGUFWNSGTG-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=Cc1c[nH]c2ccccc12)NC(=O)c1ccccc1 |
|
~%
2-benzamido-3-(... CAS#:85622-38-4 |
| Literature: Oba, Makoto; Ueno, Ryuichi; Fukuoka, Mika; Kainosho, Masatsune; Nishiyama, Kozaburo Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 12 p. 1603 - 1610 |
| 2-Propenoic acid,2-(benzoylamino)-3-(1H-indol-3-yl)-,(Z) |
| (Z)-2-benzamido-3-(indol-3'-yl)propenoic acid |