4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol
4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol structure
|
Common Name | 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 85628-55-3 | Molecular Weight | 225.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO3 |
|---|---|
| Molecular Weight | 225.28400 |
| Exact Mass | 225.13600 |
| PSA | 64.71000 |
| LogP | 2.38950 |
| InChIKey | YDJMNLCBFCKFRU-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(C)(C)N)cc(OC)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~83%
4-(2-amino-2-me... CAS#:85628-55-3 |
| Literature: Renger Archiv der Pharmazie, 1983 , vol. 316, # 3 p. 193 - 201 |
|
~%
4-(2-amino-2-me... CAS#:85628-55-3 |
| Literature: Renger Archiv der Pharmazie, 1983 , vol. 316, # 3 p. 193 - 201 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phenol,4-(2-amino-2-methylpropyl)-2,6-dimethoxy |
| 2,6-Dimethoxy-4-(2-amino-2-methylpropyl)phenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: Molecular formula of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is C12H19NO3. |
| Q: What is the InChIKey of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: InChIKey of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is YDJMNLCBFCKFRU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: SMILES notation of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is COc1cc(CC(C)(C)N)cc(OC)c1O. |
| Q: What is the polar surface area (PSA) of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: Polar surface area (PSA) of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is 64.71000. |
| Q: What English synonyms does 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol have? |
| A: English synonyms of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol: Phenol,4-(2-amino-2-methylpropyl)-2,6-dimethoxy, 2,6-Dimethoxy-4-(2-amino-2-methylpropyl)phenol. |
| Q: What is the CAS number of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: CAS number of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is 85628-55-3. |
| Q: What is the LogP of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: LogP of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is 2.38950. |
| Q: What is the molecular weight of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: Molecular weight of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is 225.28400. |
| Q: What is the English name of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol? |
| A: The English name of 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol is 4-(2-amino-2-methylpropyl)-2,6-dimethoxyphenol. |
| Q: What is the Chinese name of 85628-55-3? |
| A: Chinese name of 85628-55-3 is 85628-55-3. |