Carbamic acid,N,N-diethyl-, 4-methoxyphenyl ester structure
|
Common Name | Carbamic acid,N,N-diethyl-, 4-methoxyphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 85630-18-8 | Molecular Weight | 223.26800 | |
| Density | 1.074g/cm3 | Boiling Point | 316.5ºC at 760 mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.2ºC | |
| Name | (4-methoxyphenyl) N,N-diethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 316.5ºC at 760 mmHg |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 145.2ºC |
| Exact Mass | 223.12100 |
| PSA | 38.77000 |
| LogP | 2.53580 |
| Index of Refraction | 1.507 |
| InChIKey | ULYHZFSLDZHJHM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)Oc1ccc(OC)cc1 |
|
~92%
Carbamic acid,N... CAS#:85630-18-8 |
| Literature: Quasdorf, Kyle W.; Riener, Michelle; Petrova, Krastina V.; Garg, Neil K. Journal of the American Chemical Society, 2009 , vol. 131, # 49 p. 17748 - 17749 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| N,N-diethyl-O-(4-methoxyphenyl)carbamate |
| 4-methoxyphenyl diethylcarbamate |
| 4-methoxyphenyl N,N-diethyl carbamate |
| diethyl carbamic acid (4-methoxyphenyl ester) |
| N,N-diethylcarbamate |
| Diaethyl-carbamidsaeure-(4-methoxy-phenylester) |