N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine
Modify Date: 2025-08-23 18:19:13
N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine structure
|
Common Name | N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine | ||
|---|---|---|---|---|
| CAS Number | 856357-97-6 | Molecular Weight | 296.80 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21ClN6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21ClN6 |
|---|---|
| Molecular Weight | 296.80 |
| InChIKey | DJUJBMNJUHBMSU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNc1nc(Cl)nc2ncn(C)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine? |
| A: Molecular weight of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine is 296.80. |
| Q: What is the English name of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine? |
| A: The English name of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine is N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine. |
| Q: What is the CAS number of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine? |
| A: CAS number of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine is 856357-97-6. |
| Q: What is the Chinese name of 856357-97-6? |
| A: Chinese name of 856357-97-6 is 856357-97-6. |
| Q: What is the InChIKey of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine? |
| A: InChIKey of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine is DJUJBMNJUHBMSU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine? |
| A: Molecular formula of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine is C13H21ClN6. |
| Q: What is the SMILES notation of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine? |
| A: SMILES notation of N3-(2-Chloro-7-methyl-7H-purin-6-yl)-N1,N1-diethyl-1,3-propanediamine is CCN(CC)CCCNc1nc(Cl)nc2ncn(C)c12. |