4'-Hydroxy-2'-glutathione conjugated monoclofenac
Modify Date: 2025-09-23 17:34:04
4'-Hydroxy-2'-glutathione conjugated monoclofenac structure
|
Common Name | 4'-Hydroxy-2'-glutathione conjugated monoclofenac | ||
|---|---|---|---|---|
| CAS Number | 856412-03-8 | Molecular Weight | 583.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27ClN4O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4'-Hydroxy-2'-glutathione conjugated monoclofenac |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H27ClN4O9S |
|---|---|
| Molecular Weight | 583.0 |
| InChIKey | XTFRUXITOHUVCH-RDJZCZTQSA-N |
| SMILES | NC(CCC(=O)NC(CSc1cc(O)cc(Cl)c1Nc1ccccc1CC(=O)O)C(=O)NCC(=O)O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 856412-03-8? |
| A: Chinese name of 856412-03-8 is 856412-03-8. |
| Q: What is the molecular formula of 4'-Hydroxy-2'-glutathione conjugated monoclofenac? |
| A: Molecular formula of 4'-Hydroxy-2'-glutathione conjugated monoclofenac is C24H27ClN4O9S. |
| Q: What is the CAS number of 4'-Hydroxy-2'-glutathione conjugated monoclofenac? |
| A: CAS number of 4'-Hydroxy-2'-glutathione conjugated monoclofenac is 856412-03-8. |
| Q: What is the InChIKey of 4'-Hydroxy-2'-glutathione conjugated monoclofenac? |
| A: InChIKey of 4'-Hydroxy-2'-glutathione conjugated monoclofenac is XTFRUXITOHUVCH-RDJZCZTQSA-N. |
| Q: What is the English name of 4'-Hydroxy-2'-glutathione conjugated monoclofenac? |
| A: The English name of 4'-Hydroxy-2'-glutathione conjugated monoclofenac is 4'-Hydroxy-2'-glutathione conjugated monoclofenac. |
| Q: What is the SMILES notation of 4'-Hydroxy-2'-glutathione conjugated monoclofenac? |
| A: SMILES notation of 4'-Hydroxy-2'-glutathione conjugated monoclofenac is NC(CCC(=O)NC(CSc1cc(O)cc(Cl)c1Nc1ccccc1CC(=O)O)C(=O)NCC(=O)O)C(=O)O. |
| Q: What is the molecular weight of 4'-Hydroxy-2'-glutathione conjugated monoclofenac? |
| A: Molecular weight of 4'-Hydroxy-2'-glutathione conjugated monoclofenac is 583.0. |