4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one
Modify Date: 2026-07-08 06:18:40
4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one structure
|
Common Name | 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 856413-55-3 | Molecular Weight | 344.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12Br2O |
|---|---|
| Molecular Weight | 344.04 |
| InChIKey | CAYJMWJFJUXZDR-UHFFFAOYSA-N |
| SMILES | CC1Cc2c(Br)c3c(c(Br)c2C1=O)CCC3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one? |
| A: The English name of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one is 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one. |
| Q: What is the SMILES notation of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one? |
| A: SMILES notation of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one is CC1Cc2c(Br)c3c(c(Br)c2C1=O)CCC3. |
| Q: What is the InChIKey of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one? |
| A: InChIKey of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one is CAYJMWJFJUXZDR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one? |
| A: Molecular formula of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one is C13H12Br2O. |
| Q: What is the CAS number of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one? |
| A: CAS number of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one is 856413-55-3. |
| Q: What is the molecular weight of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one? |
| A: Molecular weight of 4,8-Dibromo-3,5,6,7-tetrahydro-2-methyl-s-indacen-1(2H)-one is 344.04. |
| Q: What is the Chinese name of 856413-55-3? |
| A: Chinese name of 856413-55-3 is 856413-55-3. |