methyl 2-(azidocarbonyl)-3-nitrobenzoate
methyl 2-(azidocarbonyl)-3-nitrobenzoate structure
|
Common Name | methyl 2-(azidocarbonyl)-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 856414-36-3 | Molecular Weight | 250.16800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 2-(azidocarbonyl)-3-nitrobenzoate, Chinese name: 甲基2-(叠氮羰基)-3-硝基苯甲酸酯, CAS number: 856414-36-3, molecular formula: C9H6N4O5, molecular weight: 250.17. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-(azidocarbonyl)-3-nitrobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6N4O5 |
|---|---|
| Molecular Weight | 250.16800 |
| Exact Mass | 250.03400 |
| PSA | 138.94000 |
| LogP | 1.80786 |
| InChIKey | HDHRMQPAYXAOAT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1C(=O)N=[N+]=[N-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 9 | |
CAS#:57113-90-3![methyl 2-[[4-(2-cyanophenyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate structure](https://image.chemsrc.com/caspic/409/139481-38-2.png)
CAS#:139481-38-2
CAS#:57113-91-4![Ethyl 3-amino-2-{[(2'-cyano-4-biphenylyl)methyl]amino}benzoate structure](https://image.chemsrc.com/caspic/271/136285-69-3.png)
CAS#:136285-69-3
CAS#:139481-59-7![Methyl 2-(((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)amino)-3-nitrobenzoate structure](https://image.chemsrc.com/caspic/116/139481-28-0.png)
CAS#:139481-28-0![Methyl 1-((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1H-benzo[d]imidazole-7-carboxylate structure](https://image.chemsrc.com/caspic/354/139481-44-0.png)
CAS#:139481-44-0
CAS#:139481-69-9![Methyl 3-amino-2-[[(2'-cyanobiphenyl-4-yl)methyl]amino]benzoate structure](https://image.chemsrc.com/caspic/430/136304-78-4.png)
CAS#:136304-78-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: CAS number of methyl 2-(azidocarbonyl)-3-nitrobenzoate is 856414-36-3. |
| Q: What are the downstream products of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: Related downstream products(CAS) of methyl 2-(azidocarbonyl)-3-nitrobenzoate: 57113-90-3;139481-38-2;57113-91-4;136285-69-3;139481-59-7;139481-28-0;139481-44-0;139481-69-9;136304-78-4. |
| Q: What is the LogP of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: LogP of methyl 2-(azidocarbonyl)-3-nitrobenzoate is 1.80786. |
| Q: What is the polar surface area (PSA) of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: Polar surface area (PSA) of methyl 2-(azidocarbonyl)-3-nitrobenzoate is 138.94000. |
| Q: What is the Chinese name of 856414-36-3? |
| A: Chinese name of 856414-36-3 is 856414-36-3. |
| Q: What is the molecular formula of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: Molecular formula of methyl 2-(azidocarbonyl)-3-nitrobenzoate is C9H6N4O5. |
| Q: What is the molecular weight of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: Molecular weight of methyl 2-(azidocarbonyl)-3-nitrobenzoate is 250.16800. |
| Q: What is the InChIKey of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: InChIKey of methyl 2-(azidocarbonyl)-3-nitrobenzoate is HDHRMQPAYXAOAT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: SMILES notation of methyl 2-(azidocarbonyl)-3-nitrobenzoate is COC(=O)c1cccc([N+](=O)[O-])c1C(=O)N=[N+]=[N-]. |
| Q: What is the English name of methyl 2-(azidocarbonyl)-3-nitrobenzoate? |
| A: The English name of methyl 2-(azidocarbonyl)-3-nitrobenzoate is methyl 2-(azidocarbonyl)-3-nitrobenzoate. |