Sargachromanol G
Modify Date: 2025-09-13 11:04:56
Sargachromanol G structure
|
Common Name | Sargachromanol G | ||
|---|---|---|---|---|
| CAS Number | 856414-56-7 | Molecular Weight | 426.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sargachromanol G |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H38O4 |
|---|---|
| Molecular Weight | 426.6 |
| InChIKey | CBIUHPWNXBUXBG-AZIDNILZSA-N |
| SMILES | CC(C)=CC(O)C(=O)C(C)=CCCC(C)=CCCC1(C)CCc2cc(O)cc(C)c2O1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 16, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Sargachromanol G? |
| A: InChIKey of Sargachromanol G is CBIUHPWNXBUXBG-AZIDNILZSA-N. |
| Q: What is the molecular weight of Sargachromanol G? |
| A: Molecular weight of Sargachromanol G is 426.6. |
| Q: What is the molecular formula of Sargachromanol G? |
| A: Molecular formula of Sargachromanol G is C27H38O4. |
| Q: What is the SMILES notation of Sargachromanol G? |
| A: SMILES notation of Sargachromanol G is CC(C)=CC(O)C(=O)C(C)=CCCC(C)=CCCC1(C)CCc2cc(O)cc(C)c2O1. |
| Q: What is the CAS number of Sargachromanol G? |
| A: CAS number of Sargachromanol G is 856414-56-7. |
| Q: What is the English name of Sargachromanol G? |
| A: The English name of Sargachromanol G is Sargachromanol G. |
| Q: What is the Chinese name of 856414-56-7? |
| A: Chinese name of 856414-56-7 is 856414-56-7. |