Sargachromanol H
Modify Date: 2026-04-15 15:53:43
Sargachromanol H structure
|
Common Name | Sargachromanol H | ||
|---|---|---|---|---|
| CAS Number | 856414-57-8 | Molecular Weight | 428.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sargachromanol H |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H40O4 |
|---|---|
| Molecular Weight | 428.6 |
| InChIKey | CHKKJDHXYINKDR-NTNCAPJNSA-N |
| SMILES | CC1=CC(=CC2=C1O[C@](CC2)(C)CC/C=C(\C)/C/C=C\C(C)C(=O)[C@@H](CC(C)C)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 13, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Sargachromanol H? |
| A: The English name of Sargachromanol H is Sargachromanol H. |
| Q: What is the CAS number of Sargachromanol H? |
| A: CAS number of Sargachromanol H is 856414-57-8. |
| Q: What is the molecular weight of Sargachromanol H? |
| A: Molecular weight of Sargachromanol H is 428.6. |
| Q: What is the molecular formula of Sargachromanol H? |
| A: Molecular formula of Sargachromanol H is C27H40O4. |
| Q: What is the Chinese name of 856414-57-8? |
| A: Chinese name of 856414-57-8 is 856414-57-8. |
| Q: What is the SMILES notation of Sargachromanol H? |
| A: SMILES notation of Sargachromanol H is CC1=CC(=CC2=C1O[C@](CC2)(C)CC/C=C(\C)/C/C=C\C(C)C(=O)[C@@H](CC(C)C)O)O. |
| Q: What is the InChIKey of Sargachromanol H? |
| A: InChIKey of Sargachromanol H is CHKKJDHXYINKDR-NTNCAPJNSA-N. |