Sargachromanol M
Modify Date: 2026-06-27 06:55:13
Sargachromanol M structure
|
Common Name | Sargachromanol M | ||
|---|---|---|---|---|
| CAS Number | 856414-62-5 | Molecular Weight | 410.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sargachromanol M |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H38O3 |
|---|---|
| Molecular Weight | 410.6 |
| InChIKey | VYQSISDGHVLRPS-CWBAOMBQSA-N |
| SMILES | CC1=CC(=CC2=C1O[C@](CC2)(C)CC/C=C(\C)/CCC/C(=C(\C=C(C)C)/C=O)/C)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 13, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Sargachromanol M? |
| A: InChIKey of Sargachromanol M is VYQSISDGHVLRPS-CWBAOMBQSA-N. |
| Q: What is the molecular formula of Sargachromanol M? |
| A: Molecular formula of Sargachromanol M is C27H38O3. |
| Q: What is the English name of Sargachromanol M? |
| A: The English name of Sargachromanol M is Sargachromanol M. |
| Q: What is the molecular weight of Sargachromanol M? |
| A: Molecular weight of Sargachromanol M is 410.6. |
| Q: What is the SMILES notation of Sargachromanol M? |
| A: SMILES notation of Sargachromanol M is CC1=CC(=CC2=C1O[C@](CC2)(C)CC/C=C(\C)/CCC/C(=C(\C=C(C)C)/C=O)/C)O. |
| Q: What is the CAS number of Sargachromanol M? |
| A: CAS number of Sargachromanol M is 856414-62-5. |
| Q: What is the Chinese name of 856414-62-5? |
| A: Chinese name of 856414-62-5 is 856414-62-5. |