4-propionyl-4-methoxycarbonyltetrahydropyran
4-propionyl-4-methoxycarbonyltetrahydropyran structure
|
Common Name | 4-propionyl-4-methoxycarbonyltetrahydropyran | ||
|---|---|---|---|---|
| CAS Number | 856414-66-9 | Molecular Weight | 200.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Propionyl-4-methoxycarbonyltetrahydropyran, Chinese name unavailable, CAS number 856414-66-9, molecular formula C10H16O4, molecular weight 200.23200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-propionyl-4-methoxycarbonyltetrahydropyran |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16O4 |
|---|---|
| Molecular Weight | 200.23200 |
| Exact Mass | 200.10500 |
| PSA | 52.60000 |
| LogP | 0.93530 |
| InChIKey | UGDPPIJGLQLOQZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1(C(=O)OC)CCOCC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:7464-18-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: LogP of 4-propionyl-4-methoxycarbonyltetrahydropyran is 0.93530. |
| Q: What is the polar surface area (PSA) of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: Polar surface area (PSA) of 4-propionyl-4-methoxycarbonyltetrahydropyran is 52.60000. |
| Q: What is the InChIKey of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: InChIKey of 4-propionyl-4-methoxycarbonyltetrahydropyran is UGDPPIJGLQLOQZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 856414-66-9? |
| A: Chinese name of 856414-66-9 is 856414-66-9. |
| Q: What is the English name of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: The English name of 4-propionyl-4-methoxycarbonyltetrahydropyran is 4-propionyl-4-methoxycarbonyltetrahydropyran. |
| Q: What are the downstream products of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: Related downstream products(CAS) of 4-propionyl-4-methoxycarbonyltetrahydropyran: 7464-18-8. |
| Q: What is the molecular formula of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: Molecular formula of 4-propionyl-4-methoxycarbonyltetrahydropyran is C10H16O4. |
| Q: What is the SMILES notation of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: SMILES notation of 4-propionyl-4-methoxycarbonyltetrahydropyran is CCC(=O)C1(C(=O)OC)CCOCC1. |
| Q: What is the molecular weight of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: Molecular weight of 4-propionyl-4-methoxycarbonyltetrahydropyran is 200.23200. |
| Q: What is the CAS number of 4-propionyl-4-methoxycarbonyltetrahydropyran? |
| A: CAS number of 4-propionyl-4-methoxycarbonyltetrahydropyran is 856414-66-9. |