2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione
Modify Date: 2026-07-16 22:59:47
![2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione Structure](https://www.chemsrc.com/extcaspic/460/856434-98-5.png)
2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione structure
|
Common Name | 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 856434-98-5 | Molecular Weight | 336.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H16N2O4 |
|---|---|
| Molecular Weight | 336.3 |
| InChIKey | IOWIFTPTAXPYIE-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCCON1C(=O)Cc2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione? |
| A: InChIKey of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione is IOWIFTPTAXPYIE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione? |
| A: Molecular formula of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione is C19H16N2O4. |
| Q: What is the CAS number of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione? |
| A: CAS number of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione is 856434-98-5. |
| Q: What is the molecular weight of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione? |
| A: Molecular weight of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione is 336.3. |
| Q: What is the English name of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione? |
| A: The English name of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione is 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione. |
| Q: What is the SMILES notation of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione? |
| A: SMILES notation of 2-[3-(2-Oxo-2,3-dihydro-indol-1-yloxy)-propyl]-isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1CCCON1C(=O)Cc2ccccc21. |
| Q: What is the Chinese name of 856434-98-5? |
| A: Chinese name of 856434-98-5 is 856434-98-5. |