3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one
Modify Date: 2025-08-27 22:07:40
![3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one Structure](https://www.chemsrc.com/extcaspic/273/856435-23-9.png)
3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one structure
|
Common Name | 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one | ||
|---|---|---|---|---|
| CAS Number | 856435-23-9 | Molecular Weight | 304.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H16N2O2 |
|---|---|
| Molecular Weight | 304.3 |
| InChIKey | FGQWMJSNFXWRTC-CXUHLZMHSA-N |
| SMILES | COc1ccc2c(c1)c(C=C1C(=O)Nc3ccccc31)cn2C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one? |
| A: Molecular formula of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one is C19H16N2O2. |
| Q: What is the InChIKey of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one? |
| A: InChIKey of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one is FGQWMJSNFXWRTC-CXUHLZMHSA-N. |
| Q: What is the SMILES notation of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one? |
| A: SMILES notation of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one is COc1ccc2c(c1)c(C=C1C(=O)Nc3ccccc31)cn2C. |
| Q: What is the CAS number of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one? |
| A: CAS number of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one is 856435-23-9. |
| Q: What is the molecular weight of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one? |
| A: Molecular weight of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one is 304.3. |
| Q: What is the English name of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one? |
| A: The English name of 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one is 3-[(5-Methoxy-1-methyl-1H-indol-3-YL)methylene]-1,3-dihydro-2H-indol-2-one. |
| Q: What is the Chinese name of 856435-23-9? |
| A: Chinese name of 856435-23-9 is 856435-23-9. |