2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide)
Modify Date: 2026-06-26 07:42:02
2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) structure
|
Common Name | 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) | ||
|---|---|---|---|---|
| CAS Number | 856436-80-1 | Molecular Weight | 330.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N4O4 |
|---|---|
| Molecular Weight | 330.34 |
| InChIKey | AWWFNKDNSSJDTF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NNC(=O)C(C(C(=O)NNC2=CC=CC=C2)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide)? |
| A: SMILES notation of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) is C1=CC=C(C=C1)NNC(=O)C(C(C(=O)NNC2=CC=CC=C2)O)O. |
| Q: What is the Chinese name of 856436-80-1? |
| A: Chinese name of 856436-80-1 is 856436-80-1. |
| Q: What is the CAS number of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide)? |
| A: CAS number of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) is 856436-80-1. |
| Q: What is the molecular formula of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide)? |
| A: Molecular formula of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) is C16H18N4O4. |
| Q: What is the molecular weight of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide)? |
| A: Molecular weight of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) is 330.34. |
| Q: What is the InChIKey of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide)? |
| A: InChIKey of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) is AWWFNKDNSSJDTF-UHFFFAOYSA-N. |
| Q: What is the English name of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide)? |
| A: The English name of 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide) is 2,3-Dihydroxybutanedioic acid 1,4-bis(2-phenylhydrazide). |