1,2,3,4,5-pentachloro-6-(2-chloroethoxysulfonyl)benzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-(2-chloroethoxysulfonyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 85650-13-1 | Molecular Weight | 392.89900 | |
| Density | 1.744g/cm3 | Boiling Point | 510.9ºC at 760 mmHg | |
| Molecular Formula | C8H4Cl6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.8ºC | |
| Name | 2-chloroethyl 2,3,4,5,6-pentachlorobenzenesulfonate |
|---|
| Density | 1.744g/cm3 |
|---|---|
| Boiling Point | 510.9ºC at 760 mmHg |
| Molecular Formula | C8H4Cl6O3S |
| Molecular Weight | 392.89900 |
| Flash Point | 262.8ºC |
| Exact Mass | 389.80100 |
| PSA | 51.75000 |
| LogP | 5.97850 |
| Index of Refraction | 1.585 |
| InChIKey | JLLONYIVVFQZQW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCCCl)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|
~%
1,2,3,4,5-penta... CAS#:85650-13-1 |
| Literature: Shealy, Y. Fulmer; Krauth, Charles A.; Struck, Robert F.; Montgomery, John A. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1168 - 1173 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |