7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one
7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one structure
|
Common Name | 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 85657-30-3 | Molecular Weight | 372.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13IO4 |
|---|---|
| Molecular Weight | 372.15500 |
| Exact Mass | 371.98600 |
| PSA | 59.67000 |
| LogP | 3.44820 |
| InChIKey | ADFFMKWKGACATA-UHFFFAOYSA-N |
| SMILES | CC(C)=CCOc1cc(O)c(I)c2oc(=O)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
7-hydroxy-8-iod... CAS#:85657-30-3 |
| Literature: Murray; Jorge; Lawrie Tetrahedron, 1983 , vol. 39, # 19 p. 3159 - 3162 |
![7-Hydroxy-5-[(3-methyl-2-buten-1-yl)oxy]-2H-1-benzopyran-2-one structure](https://image.chemsrc.com/caspic/056/33899-44-4.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-hydroxy-8-iodo-5-(3-methylbut-2-enyl)oxycoumarin |
| 2H-1-Benzopyran-2-one,7-hydroxy-8-iodo-5-[(3-methyl-2-butenyl)oxy] |
| 8-iodocoumarin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: Molecular formula of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is C14H13IO4. |
| Q: What is the polar surface area (PSA) of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: Polar surface area (PSA) of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is 59.67000. |
| Q: What English synonyms does 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one have? |
| A: English synonyms of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one: 7-hydroxy-8-iodo-5-(3-methylbut-2-enyl)oxycoumarin, 2H-1-Benzopyran-2-one,7-hydroxy-8-iodo-5-[(3-methyl-2-butenyl)oxy], 8-iodocoumarin. |
| Q: What is the SMILES notation of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: SMILES notation of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is CC(C)=CCOc1cc(O)c(I)c2oc(=O)ccc12. |
| Q: What is the molecular weight of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: Molecular weight of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is 372.15500. |
| Q: What is the English name of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: The English name of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one. |
| Q: What is the LogP of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: LogP of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is 3.44820. |
| Q: What is the Chinese name of 85657-30-3? |
| A: Chinese name of 85657-30-3 is 85657-30-3. |
| Q: What is the CAS number of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: CAS number of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is 85657-30-3. |
| Q: What is the InChIKey of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one? |
| A: InChIKey of 7-hydroxy-8-iodo-5-(3-methylbut-2-enoxy)chromen-2-one is ADFFMKWKGACATA-UHFFFAOYSA-N. |