8-chloro-6-(2-chlorophenyl)-1-[(4-methylphenyl)sulfanylmethyl]-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine structure
|
Common Name | 8-chloro-6-(2-chlorophenyl)-1-[(4-methylphenyl)sulfanylmethyl]-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine | ||
|---|---|---|---|---|
| CAS Number | 85677-82-3 | Molecular Weight | 465.39800 | |
| Density | 1.39g/cm3 | Boiling Point | 644.8ºC at 760mmHg | |
| Molecular Formula | C24H18Cl2N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.8ºC | |
| Name | 8-chloro-6-(2-chlorophenyl)-1-[(4-methylphenyl)sulfanylmethyl]-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 644.8ºC at 760mmHg |
| Molecular Formula | C24H18Cl2N4S |
| Molecular Weight | 465.39800 |
| Flash Point | 343.8ºC |
| Exact Mass | 464.06300 |
| PSA | 68.37000 |
| LogP | 5.96140 |
| Index of Refraction | 1.71 |
| InChIKey | JJKZPGKNMIQKAY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SCc2nnc3n2-c2ccc(Cl)cc2C(c2ccccc2Cl)=NC3)cc1 |
|
~69%
8-chloro-6-(2-c... CAS#:85677-82-3 |
| Literature: Vejdelek; Metys; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 123-136) |
|
~%
8-chloro-6-(2-c... CAS#:85677-82-3 |
| Literature: Vejdelek; Metys; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 123-136) |
| 4H-(1,2,4)Triazolo(4,3-a)(1,4)benzodiazepine,8-chloro-6-(2-chlorophenyl)-1-(((4-methylphenyl)thio)methyl) |