4H-(1,2,4)Triazolo(4,3-a)(1,4)benzodiazepine, 8-chloro-6-(2-chlorophen yl)-1-((ethylthio)methyl)- structure
|
Common Name | 4H-(1,2,4)Triazolo(4,3-a)(1,4)benzodiazepine, 8-chloro-6-(2-chlorophen yl)-1-((ethylthio)methyl)- | ||
|---|---|---|---|---|
| CAS Number | 85683-65-4 | Molecular Weight | 403.32800 | |
| Density | 1.43g/cm3 | Boiling Point | 582.4ºC at 760mmHg | |
| Molecular Formula | C19H16Cl2N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306ºC | |
| Name | 8-chloro-6-(2-chlorophenyl)-1-(ethylsulfanylmethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 582.4ºC at 760mmHg |
| Molecular Formula | C19H16Cl2N4S |
| Molecular Weight | 403.32800 |
| Flash Point | 306ºC |
| Exact Mass | 402.04700 |
| PSA | 68.37000 |
| LogP | 4.61380 |
| Index of Refraction | 1.708 |
| InChIKey | SPRQSAWXZFAUCZ-UHFFFAOYSA-N |
| SMILES | CCSCc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1Cl)=NC2 |
|
~76%
4H-(1,2,4)Triaz... CAS#:85683-65-4 |
| Literature: Vejdelek; Metys; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 123-136) |
|
~%
4H-(1,2,4)Triaz... CAS#:85683-65-4 |
| Literature: Vejdelek; Metys; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 123-136) |
| 4H-(1,2,4)Triazolo(4,3-a)(1,4)benzodiazepine,8-chloro-6-(2-chlorophenyl)-1-((ethylthio)methyl) |