1-(4-Bromobenzyl)piperazine 2HCl
Modify Date: 2025-08-29 18:07:22
1-(4-Bromobenzyl)piperazine 2HCl structure
|
Common Name | 1-(4-Bromobenzyl)piperazine 2HCl | ||
|---|---|---|---|---|
| CAS Number | 856840-94-3 | Molecular Weight | 328.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17BrCl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Bromobenzyl)piperazine 2HCl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17BrCl2N2 |
|---|---|
| Molecular Weight | 328.07 |
| InChIKey | MGZBAKYKCVMSJE-UHFFFAOYSA-N |
| SMILES | Brc1ccc(CN2CCNCC2)cc1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(4-Bromobenzyl)piperazine 2HCl? |
| A: CAS number of 1-(4-Bromobenzyl)piperazine 2HCl is 856840-94-3. |
| Q: What is the Chinese name of 856840-94-3? |
| A: Chinese name of 856840-94-3 is 856840-94-3. |
| Q: What is the molecular weight of 1-(4-Bromobenzyl)piperazine 2HCl? |
| A: Molecular weight of 1-(4-Bromobenzyl)piperazine 2HCl is 328.07. |
| Q: What is the molecular formula of 1-(4-Bromobenzyl)piperazine 2HCl? |
| A: Molecular formula of 1-(4-Bromobenzyl)piperazine 2HCl is C11H17BrCl2N2. |
| Q: What is the InChIKey of 1-(4-Bromobenzyl)piperazine 2HCl? |
| A: InChIKey of 1-(4-Bromobenzyl)piperazine 2HCl is MGZBAKYKCVMSJE-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-Bromobenzyl)piperazine 2HCl? |
| A: The English name of 1-(4-Bromobenzyl)piperazine 2HCl is 1-(4-Bromobenzyl)piperazine 2HCl. |
| Q: What is the SMILES notation of 1-(4-Bromobenzyl)piperazine 2HCl? |
| A: SMILES notation of 1-(4-Bromobenzyl)piperazine 2HCl is Brc1ccc(CN2CCNCC2)cc1.Cl.Cl. |