Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*)
Modify Date: 2025-09-10 08:11:13
Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) structure
|
Common Name | Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) | ||
|---|---|---|---|---|
| CAS Number | 85688-85-3 | Molecular Weight | 220.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H24N2 |
|---|---|
| Molecular Weight | 220.35 |
| InChIKey | ZSQZMKLXZYSHCK-OKILXGFUSA-N |
| SMILES | CC(C)CC(C)(C#N)C(C)(C#N)CC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*)? |
| A: CAS number of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) is 85688-85-3. |
| Q: What is the English name of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*)? |
| A: The English name of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) is Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*). |
| Q: What is the molecular formula of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*)? |
| A: Molecular formula of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) is C14H24N2. |
| Q: What is the Chinese name of 85688-85-3? |
| A: Chinese name of 85688-85-3 is 85688-85-3. |
| Q: What is the InChIKey of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*)? |
| A: InChIKey of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) is ZSQZMKLXZYSHCK-OKILXGFUSA-N. |
| Q: What is the SMILES notation of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*)? |
| A: SMILES notation of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) is CC(C)CC(C)(C#N)C(C)(C#N)CC(C)C. |
| Q: What is the molecular weight of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*)? |
| A: Molecular weight of Butanedinitrile, 2,3-dimethyl-2,3-bis(2-methylpropyl)-, (R*,S*) is 220.35. |