phenyl 5,6,7,8-tetrahydro-1-hydroxy-2-naphthoate structure
|
Common Name | phenyl 5,6,7,8-tetrahydro-1-hydroxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 85720-85-0 | Molecular Weight | 268.30700 | |
| Density | 1.23g/cm3 | Boiling Point | 417.5ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.9ºC | |
| Name | phenyl 1-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 417.5ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 174.9ºC |
| Exact Mass | 268.11000 |
| PSA | 46.53000 |
| LogP | 3.49020 |
| Index of Refraction | 1.619 |
| InChIKey | ILYUJAPQYVAEIX-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c1ccc2c(c1O)CCCC2 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-Hydroxy-5,6,7,8-tetrahydro-naphthalin-2-carbonsaeure-phenylester |
| Phenyl 5,6,7,8-tetrahydro-1-hydroxy-2-naphthoate |
| EINECS 288-392-1 |
| Phenyl-1-hydroxy-5.6.7.8-tetrahydro-naphthoat |