4-(2-amino-5-chlorophenyl)-1-benzylpiperidin-4-ol structure
|
Common Name | 4-(2-amino-5-chlorophenyl)-1-benzylpiperidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 85732-70-3 | Molecular Weight | 316.82500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-amino-5-chlorophenyl)-1-benzylpiperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21ClN2O |
|---|---|
| Molecular Weight | 316.82500 |
| Exact Mass | 316.13400 |
| PSA | 49.49000 |
| LogP | 3.92490 |
| InChIKey | IRZJGMPCZMFNQP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1C1(O)CCN(Cc2ccccc2)CC1 |
|
~%
4-(2-amino-5-ch... CAS#:85732-70-3 |
| Literature: SYNGENTA PARTICIPATIONS AG Patent: WO2006/3494 A2, 2006 ; Location in patent: Page/Page column 129-130 ; |
|
~61%
4-(2-amino-5-ch... CAS#:85732-70-3 |
| Literature: Takai; Obase; Teranishi; Karasawa; Kubo; Shuto; Kasuya; Hashikami; Karashima; Shigenobu Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1129 - 1139 |
|
~%
4-(2-amino-5-ch... CAS#:85732-70-3 |
| Literature: Takai; Obase; Teranishi; Karasawa; Kubo; Shuto; Kasuya; Hashikami; Karashima; Shigenobu Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1129 - 1139 |
|
~%
4-(2-amino-5-ch... CAS#:85732-70-3 |
| Literature: Takai; Obase; Teranishi; Karasawa; Kubo; Shuto; Kasuya; Hashikami; Karashima; Shigenobu Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1129 - 1139 |
| 1-benzyl-4-hydroxy-4-(2-amino-5-chlorophenyl)piperidine |
| 4-Piperidinol,4-(2-amino-5-chlorophenyl)-1-(phenylmethyl) |
| 4-(2-amino-5-chlorophenyl)-1-benzyl-4-hydroxypyridine |
| 4-(2-amino-5-chloro-phenyl)-1-benzyl-piperidin-4-ol |