zinc,7,7-dimethyloctanoate,2-ethylhexanoate structure
|
Common Name | zinc,7,7-dimethyloctanoate,2-ethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 85763-75-3 | Molecular Weight | 379.84000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H34O4Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | zinc,7,7-dimethyloctanoate,2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H34O4Zn |
|---|---|
| Molecular Weight | 379.84000 |
| Exact Mass | 378.17500 |
| PSA | 80.26000 |
| LogP | 2.68310 |
| InChIKey | IZYHKNJJJILJOY-UHFFFAOYSA-L |
| SMILES | CC(C)(C)CCCCCC(=O)[O-].CCCCC(CC)C(=O)[O-].[Zn+2] |
| Zinc,2-ethylhexanoate neodecanoate complexes |
| Zinc salt of 2-ethylhexoic and neodecanoic acids |