9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione
Modify Date: 2025-09-09 18:34:58
9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione structure
|
Common Name | 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione | ||
|---|---|---|---|---|
| CAS Number | 858-42-4 | Molecular Weight | 417.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24Cl2F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24Cl2F2O2 |
|---|---|
| Molecular Weight | 417.3 |
| InChIKey | NWMSYITVQXEGJD-PAPZHHRGSA-N |
| SMILES | CC12CC(Cl)C3(Cl)C(CC(F)C4=CC(=O)C=CC43C)C1CCC2C(=O)CF |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione? |
| A: Molecular formula of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione is C21H24Cl2F2O2. |
| Q: What is the CAS number of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione? |
| A: CAS number of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione is 858-42-4. |
| Q: What is the SMILES notation of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione? |
| A: SMILES notation of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione is CC12CC(Cl)C3(Cl)C(CC(F)C4=CC(=O)C=CC43C)C1CCC2C(=O)CF. |
| Q: What is the molecular weight of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione? |
| A: Molecular weight of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione is 417.3. |
| Q: What is the InChIKey of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione? |
| A: InChIKey of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione is NWMSYITVQXEGJD-PAPZHHRGSA-N. |
| Q: What is the Chinese name of 858-42-4? |
| A: Chinese name of 858-42-4 is 858-42-4. |
| Q: What is the English name of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione? |
| A: The English name of 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione is 9a,11b-Dichloro-6a,21-difluoro-pregna-1,4-diene-3,20-dione. |