Resveratrol-3-O-sulfate sodium structure
|
Common Name | Resveratrol-3-O-sulfate sodium | ||
|---|---|---|---|---|
| CAS Number | 858127-11-4 | Molecular Weight | 330.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NaO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Resveratrol-3-O-sulfate sodiumResveratrol-3-O-sulfate (sodium) is the metabolite of Resveratrol[1]. |
| Name | sodium,[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] sulfate |
|---|---|
| Synonym | More Synonyms |
| Description | Resveratrol-3-O-sulfate (sodium) is the metabolite of Resveratrol[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H11NaO6S |
|---|---|
| Molecular Weight | 330.28800 |
| Exact Mass | 330.01700 |
| PSA | 115.27000 |
| LogP | 3.96880 |
| InChIKey | OWGXRCOCVOPKAM-TYYBGVCCSA-M |
| SMILES | O=S(=O)([O-])Oc1cc(O)cc(C=Cc2ccc(O)cc2)c1.[Na+] |
| trans Resveratrol 3-Sulfate Sodium Salt |
| 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol 1-(Hydrogen Sulfate) Monosodium Salt |