1,7-dimethylindole-2-carboxylic acid structure
|
Common Name | 1,7-dimethylindole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 858233-18-8 | Molecular Weight | 189.21100 | |
| Density | 1.21g/cm3 | Boiling Point | 399.1ºC at 760 mmHg | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.2ºC | |
| Name | 1,7-dimethylindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 399.1ºC at 760 mmHg |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21100 |
| Flash Point | 195.2ºC |
| Exact Mass | 189.07900 |
| PSA | 42.23000 |
| LogP | 2.18490 |
| Index of Refraction | 1.599 |
| InChIKey | IORFLRMMPCRQJM-UHFFFAOYSA-N |
| SMILES | Cc1cccc2cc(C(=O)O)n(C)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,7-dimethyl-1H-indole-2-carboxylic acid |
| 1,7-dimethyl-indole-2-carboxylic acid |
| 1,7-Dimethyl-indol-2-carbonsaeure |