2-[(4-chlorophenyl)amino]isonicotinic acid structure
|
Common Name | 2-[(4-chlorophenyl)amino]isonicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 85827-90-3 | Molecular Weight | 248.66500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chloroanilino)pyridine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9ClN2O2 |
|---|---|
| Molecular Weight | 248.66500 |
| Exact Mass | 248.03500 |
| PSA | 62.22000 |
| LogP | 3.24980 |
| InChIKey | SWZYBZIVMGFDNG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccnc(Nc2ccc(Cl)cc2)c1 |
| HS Code | 2933399090 |
|---|
|
~43%
2-[(4-chlorophe... CAS#:85827-90-3 |
| Literature: Samula, Kazimierz; Rostafinska, Barbara Polish Journal of Chemistry, 1981 , vol. 55, # 7/8 p. 1667 - 1672 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[(4-chlorophenyl)amino]pyridine-4-carboxylic acid |
| 2-[(4-Chlorophenyl)amino]isonicotinic acid |