4-[2-[2-(dimethylamino)ethoxy]-6-ethylbenzo[b][1]benzothiepin-5-yl]phenol structure
|
Common Name | 4-[2-[2-(dimethylamino)ethoxy]-6-ethylbenzo[b][1]benzothiepin-5-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 85850-74-4 | Molecular Weight | 417.56300 | |
| Density | 1.181g/cm3 | Boiling Point | 570.3ºC at 760mmHg | |
| Molecular Formula | C26H27NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.7ºC | |
| Name | 4-[2-[2-(dimethylamino)ethoxy]-6-ethylbenzo[b][1]benzothiepin-5-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 570.3ºC at 760mmHg |
| Molecular Formula | C26H27NO2S |
| Molecular Weight | 417.56300 |
| Flash Point | 298.7ºC |
| Exact Mass | 417.17600 |
| PSA | 58.00000 |
| LogP | 6.16630 |
| Index of Refraction | 1.632 |
| InChIKey | KVDSNIZNJKIADY-UHFFFAOYSA-N |
| SMILES | CCC1=C(c2ccc(O)cc2)c2ccc(OCCN(C)C)cc2Sc2ccccc21 |
| 3-[2-(dimethylamino)ethoxy]-10-ethyl-11-(4-hydroxyphenyl)dibenzo[b,f]thiepin |
| 3-(2-(Dimethylamino)ethoxy)-10-ethyl-11-(4-hydroxyphenyl)dibenzo(b,f)thiepin ethyl acetate |
| 4-[2-(2-dimethylaminoethyloxy)-6-ethylbenzo[b][1]benzothiepin-5-yl]phenol |
| Phenol,p-(7-(2-(dimethylamino)ethoxy)-11-ethyldibenzo(b,f)thiepin-10-yl)-,compd. with ethyl acetate (5:1) |