ent-Trachyspic acid
Modify Date: 2026-08-27 22:46:54
ent-Trachyspic acid structure
|
Common Name | ent-Trachyspic acid | ||
|---|---|---|---|---|
| CAS Number | 858519-97-8 | Molecular Weight | 412.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ent-Trachyspic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H28O9 |
|---|---|
| Molecular Weight | 412.4 |
| InChIKey | LQLCHKHILFZNKF-VHKYSDTDSA-N |
| SMILES | CCCCCCCCCC1=COC2(CC(C(=O)O)C(CC(=O)O)(C(=O)O)O2)C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ent-Trachyspic acid? |
| A: Molecular weight of ent-Trachyspic acid is 412.4. |
| Q: What is the CAS number of ent-Trachyspic acid? |
| A: CAS number of ent-Trachyspic acid is 858519-97-8. |
| Q: What is the InChIKey of ent-Trachyspic acid? |
| A: InChIKey of ent-Trachyspic acid is LQLCHKHILFZNKF-VHKYSDTDSA-N. |
| Q: What is the Chinese name of 858519-97-8? |
| A: Chinese name of 858519-97-8 is 858519-97-8. |
| Q: What is the SMILES notation of ent-Trachyspic acid? |
| A: SMILES notation of ent-Trachyspic acid is CCCCCCCCCC1=COC2(CC(C(=O)O)C(CC(=O)O)(C(=O)O)O2)C1=O. |
| Q: What is the molecular formula of ent-Trachyspic acid? |
| A: Molecular formula of ent-Trachyspic acid is C20H28O9. |
| Q: What is the English name of ent-Trachyspic acid? |
| A: The English name of ent-Trachyspic acid is ent-Trachyspic acid. |