1-Boc-4-(3-oxo-3-phenylpropenyl)piperidine structure
|
Common Name | 1-Boc-4-(3-oxo-3-phenylpropenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 858644-32-3 | Molecular Weight | 315.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4-[(E)-3-oxo-3-phenylprop-1-enyl]piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H25NO3 |
|---|---|
| Molecular Weight | 315.40700 |
| Exact Mass | 315.18300 |
| PSA | 46.61000 |
| LogP | 4.01050 |
| InChIKey | XYJDXZJRFHANJE-MDZDMXLPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C=CC(=O)c2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
1-Boc-4-(3-oxo-... CAS#:858644-32-3 |
| Literature: Merck Sharp and Dohme Limited Patent: WO2007/12900 A1, 2007 ; Location in patent: Page/Page column 16-17 ; WO 2007/012900 A1 |
|
~%
1-Boc-4-(3-oxo-... CAS#:858644-32-3 |
| Literature: Merck and Co., Inc. Patent: US6399619 B1, 2002 ; US 6399619 B1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Boc-4-(3-Oxo-3-phenylpropenyl)piperidine |
| 1,1-dimethylethyl 4-[(1E)-3-oxo-3-phenyl-1-propenyl]-1-Piperidinecarboxylate |
| tert-butyl 4-[(1E)-3-oxo-3-phenylprop-1-en-1-yl]piperidine-1-carboxylate |
| 1-(tert-butoxycarbonyl)-4-(3-oxo-3-phenylprop-1-enyl)piperidine |