1,4-dimethoxy-5-nitro-2-(p-tolylthio)benzene structure
|
Common Name | 1,4-dimethoxy-5-nitro-2-(p-tolylthio)benzene | ||
|---|---|---|---|---|
| CAS Number | 85896-13-5 | Molecular Weight | 305.34900 | |
| Density | 1.29g/cm3 | Boiling Point | 481.3ºC at 760 mmHg | |
| Molecular Formula | C15H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.9ºC | |
| Name | 1,4-dimethoxy-2-(4-methylphenyl)sulfanyl-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 481.3ºC at 760 mmHg |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.34900 |
| Flash Point | 244.9ºC |
| Exact Mass | 305.07200 |
| PSA | 89.58000 |
| LogP | 4.59480 |
| Index of Refraction | 1.619 |
| InChIKey | PDJISJMRQRYBGA-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1Sc1ccc(C)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
1,4-dimethoxy-5... CAS#:85896-13-5 |
| Literature: Kalle and Co. Patent: DE896591 , 1951 ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 288-791-0 |
| 1,4-dimethoxy-5-nitro-2-(p-tolylthio)benzene |
| 1,4-Dimethoxy-2-nitro-5-p-tolylmercapto-benzol |
| 1,4-dimethoxy-2-nitro-5-p-tolylsulfanyl-benzene |