3-chloro-4-(N-cyclohexyl-N-methylamino)aniline structure
|
Common Name | 3-chloro-4-(N-cyclohexyl-N-methylamino)aniline | ||
|---|---|---|---|---|
| CAS Number | 85896-15-7 | Molecular Weight | 238.75600 | |
| Density | 1.169g/cm3 | Boiling Point | 366.1ºC at 760 mmHg | |
| Molecular Formula | C13H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | 2-chloro-1-N-cyclohexyl-1-N-methylbenzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760 mmHg |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.75600 |
| Flash Point | 175.2ºC |
| Exact Mass | 238.12400 |
| PSA | 29.26000 |
| LogP | 4.27230 |
| Index of Refraction | 1.609 |
| InChIKey | SZFJCDGNNBDKBT-UHFFFAOYSA-N |
| SMILES | CN(c1ccc(N)cc1Cl)C1CCCCC1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Chloro-4-(N-cyclohexyl-N-methylamino)aniline |
| EINECS 288-793-1 |