Pyr-Phe-Leu-pNA structure
|
Common Name | Pyr-Phe-Leu-pNA | ||
|---|---|---|---|---|
| CAS Number | 85901-57-1 | Molecular Weight | 509.55400 | |
| Density | 1.293g/cm3 | Boiling Point | 916.4ºC at 760 mmHg | |
| Molecular Formula | C26H31N5O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 508ºC | |
| Name | N-[1-[[4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 916.4ºC at 760 mmHg |
| Molecular Formula | C26H31N5O6 |
| Molecular Weight | 509.55400 |
| Flash Point | 508ºC |
| Exact Mass | 509.22700 |
| PSA | 162.22000 |
| LogP | 3.77710 |
| Index of Refraction | 1.604 |
| InChIKey | NLVMZXVGZDVXDA-FKBYEOEOSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C1CCC(=O)N1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
L-Pyroglutamyl-L-phenylalanyl-L-leucine-p-nitroanilide--a chromogenic substrate for thiol proteinase assay.
Anal. Biochem. 143 , 293, (1984) L-Pyroglutamyl-L-phenylalanyl-L-leucine-p-nitroanilide (PFLNA)--a convenient chromogenic substrate for assay of thiol proteinases papain, ficin, and bromelain--was prepared by enzymatic synthesis with... |
| pGlu-Phe-Leu p-nitroanilide |
| Pyr-Phe-Leu-pNA |