Trt-Hse(Me)-OH.DEA
Modify Date: 2025-08-21 21:53:00
Trt-Hse(Me)-OH.DEA structure
|
Common Name | Trt-Hse(Me)-OH.DEA | ||
|---|---|---|---|---|
| CAS Number | 85918-00-9 | Molecular Weight | 448.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H36N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Trt-Hse(Me)-OH.DEA |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H36N2O3 |
|---|---|
| Molecular Weight | 448.6 |
| InChIKey | WUANKRBYRBUKNG-FTBISJDPSA-N |
| SMILES | CCNCC.COCCC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Trt-Hse(Me)-OH.DEA? |
| A: The English name of Trt-Hse(Me)-OH.DEA is Trt-Hse(Me)-OH.DEA. |
| Q: What is the molecular formula of Trt-Hse(Me)-OH.DEA? |
| A: Molecular formula of Trt-Hse(Me)-OH.DEA is C28H36N2O3. |
| Q: What is the CAS number of Trt-Hse(Me)-OH.DEA? |
| A: CAS number of Trt-Hse(Me)-OH.DEA is 85918-00-9. |
| Q: What is the Chinese name of 85918-00-9? |
| A: Chinese name of 85918-00-9 is 85918-00-9. |
| Q: What is the InChIKey of Trt-Hse(Me)-OH.DEA? |
| A: InChIKey of Trt-Hse(Me)-OH.DEA is WUANKRBYRBUKNG-FTBISJDPSA-N. |
| Q: What is the molecular weight of Trt-Hse(Me)-OH.DEA? |
| A: Molecular weight of Trt-Hse(Me)-OH.DEA is 448.6. |
| Q: What is the SMILES notation of Trt-Hse(Me)-OH.DEA? |
| A: SMILES notation of Trt-Hse(Me)-OH.DEA is CCNCC.COCCC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O. |