1-(3-chlorophenyl)-2-(3H-quinazolin-4-ylidene)ethanone structure
|
Common Name | 1-(3-chlorophenyl)-2-(3H-quinazolin-4-ylidene)ethanone | ||
|---|---|---|---|---|
| CAS Number | 85957-39-7 | Molecular Weight | 282.72400 | |
| Density | 1.28g/cm3 | Boiling Point | 464.8ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.9ºC | |
| Name | (2Z)-1-(3-chlorophenyl)-2-(3H-quinazolin-4-ylidene)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 464.8ºC at 760 mmHg |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.72400 |
| Flash Point | 234.9ºC |
| Exact Mass | 282.05600 |
| PSA | 45.75000 |
| LogP | 3.16080 |
| Index of Refraction | 1.647 |
| InChIKey | SPIHBFNASCPPJL-CXUHLZMHSA-N |
| SMILES | OC(=Cc1ncnc2ccccc12)c1cccc(Cl)c1 |
|
~71%
1-(3-chlorophen... CAS#:85957-39-7 |
| Literature: Sund; Beall; Borgfeld Journal of Chemical and Engineering Data, 1983 , vol. 28, # 4 p. 428 - 429 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(3-Chlorophenyl)-2-(4(1H)-quinazolinylidene)ethanone |
| 1-(3-CHLOROPHENYL)-1H-PYRROLO[2,3-B]PYRIDINE-3-CARBONITRILE |