3-Hydroxy-5-sulpho-2-naphthoic acid
Modify Date: 2025-09-15 13:49:11
3-Hydroxy-5-sulpho-2-naphthoic acid structure
|
Common Name | 3-Hydroxy-5-sulpho-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 86-64-6 | Molecular Weight | 268.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Hydroxy-5-sulpho-2-naphthoic acid |
|---|
| Molecular Formula | C11H8O6S |
|---|---|
| Molecular Weight | 268.24300 |
| Exact Mass | 268.00400 |
| PSA | 120.28000 |
| LogP | 2.57110 |
| InChIKey | WKOROMVLBVSPRM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cccc(S(=O)(=O)O)c2cc1O |
| HS Code | 2918290000 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:86-60-2
CAS#:132-57-0| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |