2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol
2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol structure
|
Common Name | 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol | ||
|---|---|---|---|---|
| CAS Number | 86018-04-4 | Molecular Weight | 210.13900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H10O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(4,5-Dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol, Chinese name is 2-(4,5-二羟基-1,3-二氧杂环戊烷-2-基)-1,3-二氧杂环戊烷-4,5-二醇, CAS number is 86018-04-4, molecular formula is C6H10O8, molecular weight is 210.13900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H10O8 |
|---|---|
| Molecular Weight | 210.13900 |
| Exact Mass | 210.03800 |
| PSA | 117.84000 |
| InChIKey | IQHQAQFSVKVGRM-UHFFFAOYSA-N |
| SMILES | OC1OC(C2OC(O)C(O)O2)OC1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(4,5-dihydrox... CAS#:86018-04-4 |
| Literature: Avzianova, Elena; Brooks, Sarah D. Spectrochimica Acta - Part A: Molecular and Biomolecular Spectroscopy, 2013 , vol. 101, p. 40 - 48 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| glyoxal dihydrate trimer |
| [2,2'-Bi-1,3-dioxolane]-4,4',5,5'-tetrol |
| 2,2'-bi(4,5-dihydroxy-1,3-dioxolane) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol? |
| A: Molecular weight of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol is 210.13900. |
| Q: What is the English name of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol? |
| A: The English name of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol is 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol. |
| Q: What English synonyms does 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol have? |
| A: English synonyms of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol: glyoxal dihydrate trimer, [2,2'-Bi-1,3-dioxolane]-4,4',5,5'-tetrol, 2,2'-bi(4,5-dihydroxy-1,3-dioxolane). |
| Q: What is the polar surface area (PSA) of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol? |
| A: Polar surface area (PSA) of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol is 117.84000. |
| Q: What is the molecular formula of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol? |
| A: Molecular formula of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol is C6H10O8. |
| Q: What is the SMILES notation of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol? |
| A: SMILES notation of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol is OC1OC(C2OC(O)C(O)O2)OC1O. |
| Q: What is the InChIKey of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol? |
| A: InChIKey of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol is IQHQAQFSVKVGRM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 86018-04-4? |
| A: Chinese name of 86018-04-4 is 86018-04-4. |
| Q: What is the CAS number of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol? |
| A: CAS number of 2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol is 86018-04-4. |