7-bromo-4-hydroxyquinoline-3-carboxylic acid structure
|
Common Name | 7-bromo-4-hydroxyquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 860205-92-1 | Molecular Weight | 268.064 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 408.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6±28.7 °C | |
| Name | 7-bromo-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.0±45.0 °C at 760 mmHg |
| Molecular Formula | C10H6BrNO3 |
| Molecular Weight | 268.064 |
| Flash Point | 200.6±28.7 °C |
| Exact Mass | 266.953094 |
| PSA | 70.16000 |
| LogP | 3.48 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | SKEXUXOCAHNLRH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c[nH]c2cc(Br)ccc2c1=O |
| HS Code | 2933499090 |
|---|
|
~%
7-bromo-4-hydro... CAS#:860205-92-1 |
| Literature: Journal of the American Chemical Society, , vol. 71, p. 3236 |
|
~%
7-bromo-4-hydro... CAS#:860205-92-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 41, # 25 p. 4918 - 4926 |
|
~%
7-bromo-4-hydro... CAS#:860205-92-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 41, # 25 p. 4918 - 4926 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Bromo-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid |
| 7-bromo-4-hydroxy-3-quinolinecarboxylic acid |
| 3-Quinolinecarboxylic acid, 7-bromo-1,4-dihydro-4-oxo- |
| 7-bromo-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| 3-quinolinecarboxylic acid, 7-bromo-4-hydroxy- |
| 7-bromo-4-hydroxyquinoline-3-carboxylic acid |
| 7-Brom-4-hydroxy-chinolin-3-carbonsaeure |
| 7-bromo-4-hydroxy-quinoline-3-carboxylic acid |