1H-Imidazole-1-ethanol,a-(methoxymethyl)-2-(2-phenyldiazenyl)- structure
|
Common Name | 1H-Imidazole-1-ethanol,a-(methoxymethyl)-2-(2-phenyldiazenyl)- | ||
|---|---|---|---|---|
| CAS Number | 86027-01-2 | Molecular Weight | 260.29200 | |
| Density | 1.22g/cm3 | Boiling Point | 457.3ºC at 760 mmHg | |
| Molecular Formula | C13H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.4ºC | |
| Name | 1-methoxy-3-(2-phenyldiazenylimidazol-1-yl)propan-2-ol |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 457.3ºC at 760 mmHg |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.29200 |
| Flash Point | 230.4ºC |
| Exact Mass | 260.12700 |
| PSA | 72.00000 |
| LogP | 2.30580 |
| Index of Refraction | 1.597 |
| InChIKey | PZKUHGODJAIVES-UHFFFAOYSA-N |
| SMILES | COCC(O)Cn1ccnc1N=Nc1ccccc1 |
|
~46%
1H-Imidazole-1-... CAS#:86027-01-2 |
| Literature: Salwinska, Ewa; Suwinski, Jerzy Polish Journal of Chemistry, 1981 , vol. 55, # 7/8 p. 1677 - 1679 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |