Amphimallon majalisEuropean chafer is also indexed at this headingAmphimedine structure
|
Common Name | Amphimallon majalisEuropean chafer is also indexed at this headingAmphimedine | ||
|---|---|---|---|---|
| CAS Number | 86047-14-5 | Molecular Weight | 313.31000 | |
| Density | 1.51g/cm3 | Boiling Point | 644.3ºC at 760 mmHg | |
| Molecular Formula | C19H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.5ºC | |
| Name | Amphimedine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 644.3ºC at 760 mmHg |
| Molecular Formula | C19H11N3O2 |
| Molecular Weight | 313.31000 |
| Flash Point | 343.5ºC |
| Exact Mass | 313.08500 |
| PSA | 64.85000 |
| LogP | 2.69310 |
| Index of Refraction | 1.812 |
| InChIKey | GPJKOFLDDKEODA-UHFFFAOYSA-N |
| SMILES | Cn1cc2c(cc1=O)-c1nc3ccccc3c3ccnc(c13)C2=O |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8H-Benzo(b)pyrido(4,3,2-de)(1,8)phenanthroline-8,11(10H)-dione,10-methyl |