Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride
Modify Date: 2026-06-30 23:57:56
Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride structure
|
Common Name | Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 86096-14-2 | Molecular Weight | 418.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H32ClNO3 |
|---|---|
| Molecular Weight | 418.0 |
| InChIKey | LEROINYDHUIUBD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C)C(=O)C(C)(C)CN(Cc1ccccc1)Cc1ccccc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 86096-14-2? |
| A: Chinese name of 86096-14-2 is 86096-14-2. |
| Q: What is the molecular formula of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride? |
| A: Molecular formula of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride is C24H32ClNO3. |
| Q: What is the CAS number of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride? |
| A: CAS number of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride is 86096-14-2. |
| Q: What is the SMILES notation of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride? |
| A: SMILES notation of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride is COC(=O)C(C)(C)C(=O)C(C)(C)CN(Cc1ccccc1)Cc1ccccc1.Cl. |
| Q: What is the English name of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride? |
| A: The English name of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride is Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride. |
| Q: What is the InChIKey of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride? |
| A: InChIKey of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride is LEROINYDHUIUBD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride? |
| A: Molecular weight of Methyl 5-Dibenzylamino-2,2,4,4-tetramethyl-3-ketovalerate hydrochloride is 418.0. |