3,3,5,5-Tetramethyl-2,4-piperidinedione structure
|
Common Name | 3,3,5,5-Tetramethyl-2,4-piperidinedione | ||
|---|---|---|---|---|
| CAS Number | 86096-15-3 | Molecular Weight | 169.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,5,5-Tetramethyl-2,4-piperidinedione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H15NO2 |
|---|---|
| Molecular Weight | 169.22 |
| InChIKey | VPLOWXKSLBRQIH-UHFFFAOYSA-N |
| SMILES | CC1(C)CNC(=O)C(C)(C)C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 86096-15-3? |
| A: Chinese name of 86096-15-3 is 86096-15-3. |
| Q: What is the molecular weight of 3,3,5,5-Tetramethyl-2,4-piperidinedione? |
| A: Molecular weight of 3,3,5,5-Tetramethyl-2,4-piperidinedione is 169.22. |
| Q: What is the SMILES notation of 3,3,5,5-Tetramethyl-2,4-piperidinedione? |
| A: SMILES notation of 3,3,5,5-Tetramethyl-2,4-piperidinedione is CC1(C)CNC(=O)C(C)(C)C1=O. |
| Q: What is the InChIKey of 3,3,5,5-Tetramethyl-2,4-piperidinedione? |
| A: InChIKey of 3,3,5,5-Tetramethyl-2,4-piperidinedione is VPLOWXKSLBRQIH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3,3,5,5-Tetramethyl-2,4-piperidinedione? |
| A: Molecular formula of 3,3,5,5-Tetramethyl-2,4-piperidinedione is C9H15NO2. |
| Q: What is the CAS number of 3,3,5,5-Tetramethyl-2,4-piperidinedione? |
| A: CAS number of 3,3,5,5-Tetramethyl-2,4-piperidinedione is 86096-15-3. |
| Q: What is the English name of 3,3,5,5-Tetramethyl-2,4-piperidinedione? |
| A: The English name of 3,3,5,5-Tetramethyl-2,4-piperidinedione is 3,3,5,5-Tetramethyl-2,4-piperidinedione. |