(2-phenylbenzoyl) 2-phenylbenzenecarboperoxoate structure
|
Common Name | (2-phenylbenzoyl) 2-phenylbenzenecarboperoxoate | ||
|---|---|---|---|---|
| CAS Number | 861-97-2 | Molecular Weight | 394.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-phenylbenzoyl) 2-phenylbenzenecarboperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H18O4 |
|---|---|
| Molecular Weight | 394.41900 |
| Exact Mass | 394.12100 |
| PSA | 52.60000 |
| LogP | 5.94940 |
| InChIKey | IQNQJSMARWEURN-UHFFFAOYSA-N |
| SMILES | O=C(OOC(=O)c1ccccc1-c1ccccc1)c1ccccc1-c1ccccc1 |
|
~%
(2-phenylbenzoy... CAS#:861-97-2 |
| Literature: Kenner et al. Tetrahedron, 1957 , vol. 1, p. 259,267 |
|
~33%
(2-phenylbenzoy... CAS#:861-97-2
Detail
|
| Literature: Forrester, Alexander R.; Purushotham, Vemeshetti Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 945 - 951 |
|
~0%
(2-phenylbenzoy... CAS#:861-97-2 |
| Literature: Forrester, Alexander R.; Purushotham, Vemishetti Journal of the Chemical Society, Chemical Communications, 1984 , # 22 p. 1505 - 1506 |
| bis(2-phenylbenzoyl) peroxide |
| bis-(biphenyl-2-carbonyl)-peroxide |
| Peroxide,bis([1,1'-biphenyl]-2-ylcarbonyl) |
| Di-<2-phenyl-benzoyl>-peroxid |
| Bis-(biphenyl-2-carbonyl)-peroxid |
| Bis-2-phenylbenzoylperoxid |
| Bis-o-phenylbenzoylperoxid |
| o-phenylbenzoyl peroxide |