2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one
2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one structure
|
Common Name | 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 86115-64-2 | Molecular Weight | 310.01400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11BrCl2O |
|---|---|
| Molecular Weight | 310.01400 |
| Exact Mass | 307.93700 |
| PSA | 17.07000 |
| LogP | 4.73970 |
| InChIKey | JBSBNKITSSDICA-UHFFFAOYSA-N |
| SMILES | CCCC(Br)C(=O)c1ccc(Cl)cc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
2-Bromo-1-(2,4-... CAS#:86115-64-2 |
| Literature: Fan, Zhijin; Shi, Zugui; Zhang, Haike; Liu, Xiufeng; Bao, Lili; Ma, Lin; Zuo, Xiang; Zheng, Qinxiang; Mi, Na Journal of Agricultural and Food Chemistry, 2009 , vol. 57, # 10 p. 4279 - 4286 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Pentanone,2-bromo-1-(2,4-dichlorophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one have? |
| A: English synonyms of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one: 1-Pentanone,2-bromo-1-(2,4-dichlorophenyl). |
| Q: What is the polar surface area (PSA) of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: Polar surface area (PSA) of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is 17.07000. |
| Q: What is the English name of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: The English name of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one. |
| Q: What is the SMILES notation of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: SMILES notation of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is CCCC(Br)C(=O)c1ccc(Cl)cc1Cl. |
| Q: What is the LogP of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: LogP of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is 4.73970. |
| Q: What is the CAS number of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: CAS number of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is 86115-64-2. |
| Q: What is the molecular formula of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: Molecular formula of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is C11H11BrCl2O. |
| Q: What is the InChIKey of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: InChIKey of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is JBSBNKITSSDICA-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: Related upstream materials(CAS) of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one: 61023-66-3. |
| Q: What is the molecular weight of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one? |
| A: Molecular weight of 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one is 310.01400. |