2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one structure
|
Common Name | 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 86115-64-2 | Molecular Weight | 310.01400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Bromo-1-(2,4-dichlorophenyl)pentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11BrCl2O |
|---|---|
| Molecular Weight | 310.01400 |
| Exact Mass | 307.93700 |
| PSA | 17.07000 |
| LogP | 4.73970 |
| InChIKey | JBSBNKITSSDICA-UHFFFAOYSA-N |
| SMILES | CCCC(Br)C(=O)c1ccc(Cl)cc1Cl |
|
~92%
2-Bromo-1-(2,4-... CAS#:86115-64-2 |
| Literature: Fan, Zhijin; Shi, Zugui; Zhang, Haike; Liu, Xiufeng; Bao, Lili; Ma, Lin; Zuo, Xiang; Zheng, Qinxiang; Mi, Na Journal of Agricultural and Food Chemistry, 2009 , vol. 57, # 10 p. 4279 - 4286 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Pentanone,2-bromo-1-(2,4-dichlorophenyl) |